What is the structure of phenyl cyanide?
Benzonitrile
| PubChem CID | 7505 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C7H5N or C6H5(CN) |
| Synonyms | BENZONITRILE 100-47-0 Phenyl cyanide Cyanobenzene Benzenenitrile More… |
Is benzonitrile polar or nonpolar?
Key
| Solvent | Snyder Polarity | Reich Polarity |
|---|---|---|
| Benzonitrile | 4.6 | 3.33 |
| Cyclohexanone | 4.5 | 2.81 |
| 2-Propanol | 4.3 | 5.46 |
| Chloroform | 4.3 | 2.59 |
What is the Iupac name of cytosine?
| IUPAC Name | 6-amino-1H-pyrimidin-2-one |
|---|---|
| Alternative Names | cytosine 4-Amino-2-hydroxypyrimidine 4-Amino-2(1H)-pyrimidinone 2(1H)-Pyrimidinone, 4-amino- 4-aminopyrimidin-2(1H)-one Cyt |
| Molecular Formula | C4H5N3O |
| Molar Mass | 111.104 g/mol |
| InChI | InChI=1S/C4H5N3O/c5-3-1-2-6-4(8)7-3/h1-2H,(H3,5,6,7,8) |
Is benzonitrile toxic?
* High exposure to Benzonitrile can cause headache, nausea, vomiting, weakness, confusion, dizziness, tremors, convulsions, coma and death. * Benzonitrile may affect the liver, kidneys, and nervous system.
What’s the structure of acetophenone?
Acetophenone is the organic compound with the formula C6H5C(O)CH3 (also represented by the pseudoelement symbols PhAc or BzMe). It is the simplest aromatic ketone. This colorless, viscous liquid is a precursor to useful resins and fragrances.
Is DMF more polar than water?
Workup for Polar and Water-Soluble Solvents….Solvents and Polarity.
| Solvent | Relative Polarity |
|---|---|
| 1,2-dichloroethane | 0.327 |
| DMPU | 0.352 |
| acetone | 0.355 |
| dimethylformamide (DMF) | 0.386 |